C14H10Br2ClN3 — CID 107601553
2-(1-chloroethyl)-1-(2,6-dibromophenyl)imidazo[4,5-c]pyridine (PubChem CID 107601553) has the molecular formula C14H10Br2ClN3 and a molecular weight of 415.52 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(2,6-dibromophenyl)imidazo[4,5-c]pyridine.
| Compound Name | 2-(1-chloroethyl)-1-(2,6-dibromophenyl)imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 107601553 |
| Molecular Formula | C14H10Br2ClN3 |
| Molecular Weight | 415.52 g/mol |
| Exact Mass | 412.89 |
| IUPAC Name | 2-(1-chloroethyl)-1-(2,6-dibromophenyl)imidazo[4,5-c]pyridine |
| SMILES | CC(Cl)c1nc2cnccc2n1-c1c(Br)cccc1Br |
| InChI | InChI=1S/C14H10Br2ClN3/c1-8(17)14-19-11-7-18-6-5-12(11)20(14)13-9(15)3-2-4-10(13)16/h2-8H,1H3 |
| InChIKey | JKQXVMRLYZMEQH-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.52 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|