C16H19ClF2N2 — CID 63545383
2-(1-chloroethyl)-6,7-difluoro-1-(3-methylcyclohexyl)benzimidazole (PubChem CID 63545383) has the molecular formula C16H19ClF2N2 and a molecular weight of 312.79 g/mol. Its IUPAC name is 2-(1-chloroethyl)-6,7-difluoro-1-(3-methylcyclohexyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-6,7-difluoro-1-(3-methylcyclohexyl)benzimidazole |
|---|---|
| PubChem CID | 63545383 |
| Molecular Formula | C16H19ClF2N2 |
| Molecular Weight | 312.79 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-(1-chloroethyl)-6,7-difluoro-1-(3-methylcyclohexyl)benzimidazole |
| SMILES | CC1CCCC(n2c(C(C)Cl)nc3ccc(F)c(F)c32)C1 |
| InChI | InChI=1S/C16H19ClF2N2/c1-9-4-3-5-11(8-9)21-15-13(20-16(21)10(2)17)7-6-12(18)14(15)19/h6-7,9-11H,3-5,8H2,1-2H3 |
| InChIKey | IRUIVMBQZURUQX-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.79 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|