C14H17ClF3N3 — CID 115502152
2-[2-(1-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N,N-dimethylethanamine (PubChem CID 115502152) has the molecular formula C14H17ClF3N3 and a molecular weight of 319.76 g/mol. Its IUPAC name is 2-[2-(1-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(1-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 115502152 |
| Molecular Formula | C14H17ClF3N3 |
| Molecular Weight | 319.76 g/mol |
| Exact Mass | 319.11 |
| IUPAC Name | 2-[2-(1-chloroethyl)-5-(trifluoromethyl)benzimidazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CC(Cl)c1nc2cc(C(F)(F)F)ccc2n1CCN(C)C |
| InChI | InChI=1S/C14H17ClF3N3/c1-9(15)13-19-11-8-10(14(16,17)18)4-5-12(11)21(13)7-6-20(2)3/h4-5,8-9H,6-7H2,1-3H3 |
| InChIKey | PGUQUZZZHVGFTG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.76 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|