C16H23ClFN3 — CID 43666167
3-[2-(1-chloroethyl)-5-fluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine (PubChem CID 43666167) has the molecular formula C16H23ClFN3 and a molecular weight of 311.83 g/mol. Its IUPAC name is 3-[2-(1-chloroethyl)-5-fluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine.
| Compound Name | 3-[2-(1-chloroethyl)-5-fluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine |
|---|---|
| PubChem CID | 43666167 |
| Molecular Formula | C16H23ClFN3 |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | 3-[2-(1-chloroethyl)-5-fluorobenzimidazol-1-yl]-N,N,2,2-tetramethylpropan-1-amine |
| SMILES | CC(Cl)c1nc2cc(F)ccc2n1CC(C)(C)CN(C)C |
| InChI | InChI=1S/C16H23ClFN3/c1-11(17)15-19-13-8-12(18)6-7-14(13)21(15)10-16(2,3)9-20(4)5/h6-8,11H,9-10H2,1-5H3 |
| InChIKey | NMTRGHOJIUOWNH-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|