C16H24ClN3 — CID 82334199
2-[2-(1-chloroethyl)-5-propan-2-ylbenzimidazol-1-yl]-N,N-dimethylethanamine (PubChem CID 82334199) has the molecular formula C16H24ClN3 and a molecular weight of 293.84 g/mol. Its IUPAC name is 2-[2-(1-chloroethyl)-5-propan-2-ylbenzimidazol-1-yl]-N,N-dimethylethanamine.
| Compound Name | 2-[2-(1-chloroethyl)-5-propan-2-ylbenzimidazol-1-yl]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 82334199 |
| Molecular Formula | C16H24ClN3 |
| Molecular Weight | 293.84 g/mol |
| Exact Mass | 293.17 |
| IUPAC Name | 2-[2-(1-chloroethyl)-5-propan-2-ylbenzimidazol-1-yl]-N,N-dimethylethanamine |
| SMILES | CC(C)c1ccc2c(c1)nc(C(C)Cl)n2CCN(C)C |
| InChI | InChI=1S/C16H24ClN3/c1-11(2)13-6-7-15-14(10-13)18-16(12(3)17)20(15)9-8-19(4)5/h6-7,10-12H,8-9H2,1-5H3 |
| InChIKey | MHJXMXACMNLCQY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|