C18H22N2O4 — CID 10359278
ethyl (E,4E)-5-(4-methoxyphenyl)-4-(1-methylimidazolidin-2-ylidene)-5-oxopent-2-enoate (PubChem CID 10359278) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is ethyl (E,4E)-5-(4-methoxyphenyl)-4-(1-methylimidazolidin-2-ylidene)-5-oxopent-2-enoate.
| Compound Name | ethyl (E,4E)-5-(4-methoxyphenyl)-4-(1-methylimidazolidin-2-ylidene)-5-oxopent-2-enoate |
|---|---|
| PubChem CID | 10359278 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | ethyl (E,4E)-5-(4-methoxyphenyl)-4-(1-methylimidazolidin-2-ylidene)-5-oxopent-2-enoate |
| SMILES | CCOC(=O)/C=C/C(C(=O)c1ccc(OC)cc1)=C1/NCCN1C |
| InChI | InChI=1S/C18H22N2O4/c1-4-24-16(21)10-9-15(18-19-11-12-20(18)2)17(22)13-5-7-14(23-3)8-6-13/h5-10,19H,4,11-12H2,1-3H3/b10-9+,18-15+ |
| InChIKey | DBXJQLZDVFEWNN-FMAJSODUSA-N |
| XLogP | 1.74 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|