C19H18N4O2 — CID 10359522
1-benzyl-3-propylpurino[7,8-a]pyridine-2,4-dione (PubChem CID 10359522) has the molecular formula C19H18N4O2 and a molecular weight of 334.38 g/mol. Its IUPAC name is 1-benzyl-3-propylpurino[7,8-a]pyridine-2,4-dione.
| Compound Name | 1-benzyl-3-propylpurino[7,8-a]pyridine-2,4-dione |
|---|---|
| PubChem CID | 10359522 |
| Molecular Formula | C19H18N4O2 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | 1-benzyl-3-propylpurino[7,8-a]pyridine-2,4-dione |
| SMILES | CCCn1c(=O)c2c(nc3ccccn32)n(Cc2ccccc2)c1=O |
| InChI | InChI=1S/C19H18N4O2/c1-2-11-22-18(24)16-17(20-15-10-6-7-12-21(15)16)23(19(22)25)13-14-8-4-3-5-9-14/h3-10,12H,2,11,13H2,1H3 |
| InChIKey | LDLBAAURBBVHGB-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 61.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |