C12H15ClFNOS — CID 103595542
(4-chloro-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanol (PubChem CID 103595542) has the molecular formula C12H15ClFNOS and a molecular weight of 275.78 g/mol. Its IUPAC name is (4-chloro-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanol.
| Compound Name | (4-chloro-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanol |
|---|---|
| PubChem CID | 103595542 |
| Molecular Formula | C12H15ClFNOS |
| Molecular Weight | 275.78 g/mol |
| Exact Mass | 275.05 |
| IUPAC Name | (4-chloro-2-fluorophenyl)-(4-methylthiomorpholin-3-yl)methanol |
| SMILES | CN1CCSCC1C(O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C12H15ClFNOS/c1-15-4-5-17-7-11(15)12(16)9-3-2-8(13)6-10(9)14/h2-3,6,11-12,16H,4-5,7H2,1H3 |
| InChIKey | RCUNIWPPFMFFQU-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.78 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |