C20H22N2O3 — CID 10359772
ethyl 4-acetyl-3-methyl-5-[(5-methyl-1H-indol-3-yl)methyl]-1H-pyrrole-2-carboxylate (PubChem CID 10359772) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is ethyl 4-acetyl-3-methyl-5-[(5-methyl-1H-indol-3-yl)methyl]-1H-pyrrole-2-carboxylate.
| Compound Name | ethyl 4-acetyl-3-methyl-5-[(5-methyl-1H-indol-3-yl)methyl]-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 10359772 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | ethyl 4-acetyl-3-methyl-5-[(5-methyl-1H-indol-3-yl)methyl]-1H-pyrrole-2-carboxylate |
| SMILES | CCOC(=O)c1[nH]c(Cc2c[nH]c3ccc(C)cc23)c(C(C)=O)c1C |
| InChI | InChI=1S/C20H22N2O3/c1-5-25-20(24)19-12(3)18(13(4)23)17(22-19)9-14-10-21-16-7-6-11(2)8-15(14)16/h6-8,10,21-22H,5,9H2,1-4H3 |
| InChIKey | AQZSMXZGGQMLRG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 74.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |