C18H22ClN3O3 — CID 90485840
ethyl 5-[[2-(5-methyl-1H-indol-3-yl)ethylamino]methyl]-1,2-oxazole-3-carboxylate;hydrochloride (PubChem CID 90485840) has the molecular formula C18H22ClN3O3 and a molecular weight of 363.85 g/mol. Its IUPAC name is ethyl 5-[[2-(5-methyl-1H-indol-3-yl)ethylamino]methyl]-1,2-oxazole-3-carboxylate;hydrochloride.
| Compound Name | ethyl 5-[[2-(5-methyl-1H-indol-3-yl)ethylamino]methyl]-1,2-oxazole-3-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 90485840 |
| Molecular Formula | C18H22ClN3O3 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | ethyl 5-[[2-(5-methyl-1H-indol-3-yl)ethylamino]methyl]-1,2-oxazole-3-carboxylate;hydrochloride |
| SMILES | CCOC(=O)c1cc(CNCCc2c[nH]c3ccc(C)cc23)on1.Cl |
| InChI | InChI=1S/C18H21N3O3.ClH/c1-3-23-18(22)17-9-14(24-21-17)11-19-7-6-13-10-20-16-5-4-12(2)8-15(13)16;/h4-5,8-10,19-20H,3,6-7,11H2,1-2H3;1H |
| InChIKey | XCTASGYFLKEHGU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 80.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|