C20H19N3O4S — CID 103597898
3-[4-(cyclopropylsulfamoyl)phenyl]-N-(2-methyl-1,3-benzoxazol-6-yl)prop-2-enamide (PubChem CID 103597898) has the molecular formula C20H19N3O4S and a molecular weight of 397.46 g/mol. Its IUPAC name is 3-[4-(cyclopropylsulfamoyl)phenyl]-N-(2-methyl-1,3-benzoxazol-6-yl)prop-2-enamide.
| Compound Name | 3-[4-(cyclopropylsulfamoyl)phenyl]-N-(2-methyl-1,3-benzoxazol-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 103597898 |
| Molecular Formula | C20H19N3O4S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | 3-[4-(cyclopropylsulfamoyl)phenyl]-N-(2-methyl-1,3-benzoxazol-6-yl)prop-2-enamide |
| SMILES | Cc1nc2ccc(NC(=O)C=Cc3ccc(S(=O)(=O)NC4CC4)cc3)cc2o1 |
| InChI | InChI=1S/C20H19N3O4S/c1-13-21-18-10-7-16(12-19(18)27-13)22-20(24)11-4-14-2-8-17(9-3-14)28(25,26)23-15-5-6-15/h2-4,7-12,15,23H,5-6H2,1H3,(H,22,24) |
| InChIKey | BCJGEZXDJMQQSD-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|