C13H9F4N3O2S — CID 103598210
3-(3-fluoro-4-methoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 103598210) has the molecular formula C13H9F4N3O2S and a molecular weight of 347.29 g/mol. Its IUPAC name is 3-(3-fluoro-4-methoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | 3-(3-fluoro-4-methoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 103598210 |
| Molecular Formula | C13H9F4N3O2S |
| Molecular Weight | 347.29 g/mol |
| Exact Mass | 347.04 |
| IUPAC Name | 3-(3-fluoro-4-methoxyphenyl)-N-[5-(trifluoromethyl)-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | COc1ccc(C=CC(=O)Nc2nnc(C(F)(F)F)s2)cc1F |
| InChI | InChI=1S/C13H9F4N3O2S/c1-22-9-4-2-7(6-8(9)14)3-5-10(21)18-12-20-19-11(23-12)13(15,16)17/h2-6H,1H3,(H,18,20,21) |
| InChIKey | BTWKMEVECKTEFX-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.29 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|