C20H18ClN3O3 — CID 103599760
N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide (PubChem CID 103599760) has the molecular formula C20H18ClN3O3 and a molecular weight of 383.84 g/mol. Its IUPAC name is N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide.
| Compound Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 103599760 |
| Molecular Formula | C20H18ClN3O3 |
| Molecular Weight | 383.84 g/mol |
| Exact Mass | 383.10 |
| IUPAC Name | N-[[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]methyl]-3-[5-(2-methylcyclopropyl)furan-2-yl]prop-2-enamide |
| SMILES | CC1CC1c1ccc(C=CC(=O)NCc2nc(-c3ccc(Cl)cc3)no2)o1 |
| InChI | InChI=1S/C20H18ClN3O3/c1-12-10-16(12)17-8-6-15(26-17)7-9-18(25)22-11-19-23-20(24-27-19)13-2-4-14(21)5-3-13/h2-9,12,16H,10-11H2,1H3,(H,22,25) |
| InChIKey | VJBUIZKFKKLBOQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.84 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|