C17H36O3Si2 — CID 10360165
(2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-enal (PubChem CID 10360165) has the molecular formula C17H36O3Si2 and a molecular weight of 344.64 g/mol. Its IUPAC name is (2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-enal.
| Compound Name | (2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-enal |
|---|---|
| PubChem CID | 10360165 |
| Molecular Formula | C17H36O3Si2 |
| Molecular Weight | 344.64 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (2R,3S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]pent-4-enal |
| SMILES | C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H36O3Si2/c1-12-14(19-21(8,9)16(2,3)4)15(13-18)20-22(10,11)17(5,6)7/h12-15H,1H2,2-11H3/t14-,15-/m0/s1 |
| InChIKey | SRYAVFVTEREJHD-GJZGRUSLSA-N |
| XLogP | 5.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|