C21H42O3Si2 — CID 10810922
(2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enal (PubChem CID 10810922) has the molecular formula C21H42O3Si2 and a molecular weight of 398.74 g/mol. Its IUPAC name is (2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enal.
| Compound Name | (2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enal |
|---|---|
| PubChem CID | 10810922 |
| Molecular Formula | C21H42O3Si2 |
| Molecular Weight | 398.74 g/mol |
| Exact Mass | 398.27 |
| IUPAC Name | (2S)-2,3-bis[[tert-butyl(dimethyl)silyl]oxy]-3-prop-2-enylhex-5-enal |
| SMILES | C=CCC(CC=C)(O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H42O3Si2/c1-13-15-21(16-14-2,24-26(11,12)20(6,7)8)18(17-22)23-25(9,10)19(3,4)5/h13-14,17-18H,1-2,15-16H2,3-12H3/t18-/m1/s1 |
| InChIKey | QTFKAPOUDRGYIC-GOSISDBHSA-N |
| XLogP | 6.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.74 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|