C18H22N2O — CID 103603774
2-(2,2-diphenylethylamino)-N-methylpropanamide (PubChem CID 103603774) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is 2-(2,2-diphenylethylamino)-N-methylpropanamide.
| Compound Name | 2-(2,2-diphenylethylamino)-N-methylpropanamide |
|---|---|
| PubChem CID | 103603774 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | 2-(2,2-diphenylethylamino)-N-methylpropanamide |
| SMILES | CNC(=O)C(C)NCC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C18H22N2O/c1-14(18(21)19-2)20-13-17(15-9-5-3-6-10-15)16-11-7-4-8-12-16/h3-12,14,17,20H,13H2,1-2H3,(H,19,21) |
| InChIKey | MSLHOWHVQYGMEC-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |