C18H20N2O2 — CID 15634660
N,N'-dimethyl-2,3-diphenylbutanediamide (PubChem CID 15634660) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N,N'-dimethyl-2,3-diphenylbutanediamide.
| Compound Name | N,N'-dimethyl-2,3-diphenylbutanediamide |
|---|---|
| PubChem CID | 15634660 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | N,N'-dimethyl-2,3-diphenylbutanediamide |
| SMILES | CNC(=O)C(c1ccccc1)C(C(=O)NC)c1ccccc1 |
| InChI | InChI=1S/C18H20N2O2/c1-19-17(21)15(13-9-5-3-6-10-13)16(18(22)20-2)14-11-7-4-8-12-14/h3-12,15-16H,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | ZTKRHMORDHPNEV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |