C11H11FN2O — CID 103605027
1-(4-fluorophenyl)-N-(1,2-oxazol-5-ylmethyl)methanamine (PubChem CID 103605027) has the molecular formula C11H11FN2O and a molecular weight of 206.22 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-(1,2-oxazol-5-ylmethyl)methanamine.
| Compound Name | 1-(4-fluorophenyl)-N-(1,2-oxazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 103605027 |
| Molecular Formula | C11H11FN2O |
| Molecular Weight | 206.22 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 1-(4-fluorophenyl)-N-(1,2-oxazol-5-ylmethyl)methanamine |
| SMILES | Fc1ccc(CNCc2ccno2)cc1 |
| InChI | InChI=1S/C11H11FN2O/c12-10-3-1-9(2-4-10)7-13-8-11-5-6-14-15-11/h1-6,13H,7-8H2 |
| InChIKey | SMOYIVVZCPRWGZ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.22 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |