C11H10F2N2O2 — CID 106415418
2,6-difluoro-4-[(1,2-oxazol-5-ylmethylamino)methyl]phenol (PubChem CID 106415418) has the molecular formula C11H10F2N2O2 and a molecular weight of 240.21 g/mol. Its IUPAC name is 2,6-difluoro-4-[(1,2-oxazol-5-ylmethylamino)methyl]phenol.
| Compound Name | 2,6-difluoro-4-[(1,2-oxazol-5-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 106415418 |
| Molecular Formula | C11H10F2N2O2 |
| Molecular Weight | 240.21 g/mol |
| Exact Mass | 240.07 |
| IUPAC Name | 2,6-difluoro-4-[(1,2-oxazol-5-ylmethylamino)methyl]phenol |
| SMILES | Oc1c(F)cc(CNCc2ccno2)cc1F |
| InChI | InChI=1S/C11H10F2N2O2/c12-9-3-7(4-10(13)11(9)16)5-14-6-8-1-2-15-17-8/h1-4,14,16H,5-6H2 |
| InChIKey | IKZWETJDJIDUQJ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.21 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |