C11H11FN2O2 — CID 106415448
2-fluoro-6-[(1,2-oxazol-5-ylmethylamino)methyl]phenol (PubChem CID 106415448) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-fluoro-6-[(1,2-oxazol-5-ylmethylamino)methyl]phenol.
| Compound Name | 2-fluoro-6-[(1,2-oxazol-5-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 106415448 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | 2-fluoro-6-[(1,2-oxazol-5-ylmethylamino)methyl]phenol |
| SMILES | Oc1c(F)cccc1CNCc1ccno1 |
| InChI | InChI=1S/C11H11FN2O2/c12-10-3-1-2-8(11(10)15)6-13-7-9-4-5-14-16-9/h1-5,13,15H,6-7H2 |
| InChIKey | XYARHEOMYXJISZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|