C12H13FN2O2 — CID 112606725
2-fluoro-6-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]phenol (PubChem CID 112606725) has the molecular formula C12H13FN2O2 and a molecular weight of 236.25 g/mol. Its IUPAC name is 2-fluoro-6-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]phenol.
| Compound Name | 2-fluoro-6-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 112606725 |
| Molecular Formula | C12H13FN2O2 |
| Molecular Weight | 236.25 g/mol |
| Exact Mass | 236.10 |
| IUPAC Name | 2-fluoro-6-[[(5-methyl-1,2-oxazol-3-yl)methylamino]methyl]phenol |
| SMILES | Cc1cc(CNCc2cccc(F)c2O)no1 |
| InChI | InChI=1S/C12H13FN2O2/c1-8-5-10(15-17-8)7-14-6-9-3-2-4-11(13)12(9)16/h2-5,14,16H,6-7H2,1H3 |
| InChIKey | KRAXZQMOGSLGTG-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.25 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|