C11H11ClN2O2 — CID 106415014
4-chloro-2-[(1,2-oxazol-5-ylmethylamino)methyl]phenol (PubChem CID 106415014) has the molecular formula C11H11ClN2O2 and a molecular weight of 238.67 g/mol. Its IUPAC name is 4-chloro-2-[(1,2-oxazol-5-ylmethylamino)methyl]phenol.
| Compound Name | 4-chloro-2-[(1,2-oxazol-5-ylmethylamino)methyl]phenol |
|---|---|
| PubChem CID | 106415014 |
| Molecular Formula | C11H11ClN2O2 |
| Molecular Weight | 238.67 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | 4-chloro-2-[(1,2-oxazol-5-ylmethylamino)methyl]phenol |
| SMILES | Oc1ccc(Cl)cc1CNCc1ccno1 |
| InChI | InChI=1S/C11H11ClN2O2/c12-9-1-2-11(15)8(5-9)6-13-7-10-3-4-14-16-10/h1-5,13,15H,6-7H2 |
| InChIKey | KMXIEANTNZSNGX-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.67 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|