4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid

C12H11FN2O3 — CID 106419858

IUPAC4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid
SMILESO=C(O)c1ccc(F)c(CNCc2ccno2)c1
InChIInChI=1S/C12H11FN2O3/c13-11-2-1-8(12(16)17)5-9(11)6-14-7-10-3-4-15-18-10/h1-5,14H,6-7H2,(H,16,17)
InChIKeyUBIYJPBLSJWLKJ-UHFFFAOYSA-N
MW250.23 g/mol
LogP1.80
Rot. Bonds5

About 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid

4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid (PubChem CID 106419858) has the molecular formula C12H11FN2O3 and a molecular weight of 250.23 g/mol. Its IUPAC name is 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid.

Molecular Properties

Compound Name4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid
PubChem CID106419858
Molecular FormulaC12H11FN2O3
Molecular Weight250.23 g/mol
Exact Mass250.08
IUPAC Name4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid
SMILESO=C(O)c1ccc(F)c(CNCc2ccno2)c1
InChIInChI=1S/C12H11FN2O3/c13-11-2-1-8(12(16)17)5-9(11)6-14-7-10-3-4-15-18-10/h1-5,14H,6-7H2,(H,16,17)
InChIKeyUBIYJPBLSJWLKJ-UHFFFAOYSA-N
XLogP1.80
TPSA75.36 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500250.23
LogP ≤ 51.80
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid?
The IUPAC name of 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid (CID 106419858) is 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid.
What is the SMILES notation for 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid?
The canonical SMILES for 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid is O=C(O)c1ccc(F)c(CNCc2ccno2)c1.
What is the InChIKey of 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid?
The InChIKey is UBIYJPBLSJWLKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11FN2O3/c13-11-2-1-8(12(16)17)5-9(11)6-14-7-10-3-4-15-18-10/h1-5,14H,6-7H2,(H,16,17).
What are the key properties of 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid?
4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid has a molecular weight of 250.23 g/mol, XLogP of 1.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-[(1,2-oxazol-5-ylmethylamino)methyl]benzoic acid is sourced from PubChem (CID 106419858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).