C15H15FN2O3 — CID 107452324
4-fluoro-3-[[(2-methoxy-3-pyridinyl)methylamino]methyl]benzoic acid (PubChem CID 107452324) has the molecular formula C15H15FN2O3 and a molecular weight of 290.29 g/mol. Its IUPAC name is 4-fluoro-3-[[(2-methoxy-3-pyridinyl)methylamino]methyl]benzoic acid.
| Compound Name | 4-fluoro-3-[[(2-methoxy-3-pyridinyl)methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 107452324 |
| Molecular Formula | C15H15FN2O3 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 4-fluoro-3-[[(2-methoxy-3-pyridinyl)methylamino]methyl]benzoic acid |
| SMILES | COc1ncccc1CNCc1cc(C(=O)O)ccc1F |
| InChI | InChI=1S/C15H15FN2O3/c1-21-14-11(3-2-6-18-14)8-17-9-12-7-10(15(19)20)4-5-13(12)16/h2-7,17H,8-9H2,1H3,(H,19,20) |
| InChIKey | CKAUFZMBMBDPQD-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |