C13H15ClN2OS — CID 103701993
4-chloro-2-[[(5-ethyl-1,3-thiazol-2-yl)methylamino]methyl]phenol (PubChem CID 103701993) has the molecular formula C13H15ClN2OS and a molecular weight of 282.80 g/mol. Its IUPAC name is 4-chloro-2-[[(5-ethyl-1,3-thiazol-2-yl)methylamino]methyl]phenol.
| Compound Name | 4-chloro-2-[[(5-ethyl-1,3-thiazol-2-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 103701993 |
| Molecular Formula | C13H15ClN2OS |
| Molecular Weight | 282.80 g/mol |
| Exact Mass | 282.06 |
| IUPAC Name | 4-chloro-2-[[(5-ethyl-1,3-thiazol-2-yl)methylamino]methyl]phenol |
| SMILES | CCc1cnc(CNCc2cc(Cl)ccc2O)s1 |
| InChI | InChI=1S/C13H15ClN2OS/c1-2-11-7-16-13(18-11)8-15-6-9-5-10(14)3-4-12(9)17/h3-5,7,15,17H,2,6,8H2,1H3 |
| InChIKey | OVIQFKHHVXGXCO-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.80 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|