C12H13BrN2OS — CID 103700725
4-bromo-2-[[(5-methyl-1,3-thiazol-2-yl)methylamino]methyl]phenol (PubChem CID 103700725) has the molecular formula C12H13BrN2OS and a molecular weight of 313.22 g/mol. Its IUPAC name is 4-bromo-2-[[(5-methyl-1,3-thiazol-2-yl)methylamino]methyl]phenol.
| Compound Name | 4-bromo-2-[[(5-methyl-1,3-thiazol-2-yl)methylamino]methyl]phenol |
|---|---|
| PubChem CID | 103700725 |
| Molecular Formula | C12H13BrN2OS |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.99 |
| IUPAC Name | 4-bromo-2-[[(5-methyl-1,3-thiazol-2-yl)methylamino]methyl]phenol |
| SMILES | Cc1cnc(CNCc2cc(Br)ccc2O)s1 |
| InChI | InChI=1S/C12H13BrN2OS/c1-8-5-15-12(17-8)7-14-6-9-4-10(13)2-3-11(9)16/h2-5,14,16H,6-7H2,1H3 |
| InChIKey | SLVINHCKRGRSJU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|