C15H15BrN2OS — CID 103700599
1-(5-bromo-2-prop-2-ynoxyphenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine (PubChem CID 103700599) has the molecular formula C15H15BrN2OS and a molecular weight of 351.27 g/mol. Its IUPAC name is 1-(5-bromo-2-prop-2-ynoxyphenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine.
| Compound Name | 1-(5-bromo-2-prop-2-ynoxyphenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 103700599 |
| Molecular Formula | C15H15BrN2OS |
| Molecular Weight | 351.27 g/mol |
| Exact Mass | 350.01 |
| IUPAC Name | 1-(5-bromo-2-prop-2-ynoxyphenyl)-N-[(5-methyl-1,3-thiazol-2-yl)methyl]methanamine |
| SMILES | C#CCOc1ccc(Br)cc1CNCc1ncc(C)s1 |
| InChI | InChI=1S/C15H15BrN2OS/c1-3-6-19-14-5-4-13(16)7-12(14)9-17-10-15-18-8-11(2)20-15/h1,4-5,7-8,17H,6,9-10H2,2H3 |
| InChIKey | NEYFRHGZBKZAHV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|