C13H13BrN4O — CID 60979432
1-(5-bromo-2-prop-2-ynoxyphenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine (PubChem CID 60979432) has the molecular formula C13H13BrN4O and a molecular weight of 321.18 g/mol. Its IUPAC name is 1-(5-bromo-2-prop-2-ynoxyphenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine.
| Compound Name | 1-(5-bromo-2-prop-2-ynoxyphenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 60979432 |
| Molecular Formula | C13H13BrN4O |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 320.03 |
| IUPAC Name | 1-(5-bromo-2-prop-2-ynoxyphenyl)-N-(1H-1,2,4-triazol-5-ylmethyl)methanamine |
| SMILES | C#CCOc1ccc(Br)cc1CNCc1ncn[nH]1 |
| InChI | InChI=1S/C13H13BrN4O/c1-2-5-19-12-4-3-11(14)6-10(12)7-15-8-13-16-9-17-18-13/h1,3-4,6,9,15H,5,7-8H2,(H,16,17,18) |
| InChIKey | LUDKFHHRDCXOGW-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|