C17H23BrN2O — CID 105414636
1-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]-N,N-dimethylcyclobutan-1-amine (PubChem CID 105414636) has the molecular formula C17H23BrN2O and a molecular weight of 351.29 g/mol. Its IUPAC name is 1-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]-N,N-dimethylcyclobutan-1-amine.
| Compound Name | 1-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]-N,N-dimethylcyclobutan-1-amine |
|---|---|
| PubChem CID | 105414636 |
| Molecular Formula | C17H23BrN2O |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 1-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]-N,N-dimethylcyclobutan-1-amine |
| SMILES | C#CCOc1ccc(Br)cc1CNCC1(N(C)C)CCC1 |
| InChI | InChI=1S/C17H23BrN2O/c1-4-10-21-16-7-6-15(18)11-14(16)12-19-13-17(20(2)3)8-5-9-17/h1,6-7,11,19H,5,8-10,12-13H2,2-3H3 |
| InChIKey | UXTXSIAAYPFSQB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|