C16H21BrN2O2 — CID 115593652
2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-N,N-diethylacetamide (PubChem CID 115593652) has the molecular formula C16H21BrN2O2 and a molecular weight of 353.26 g/mol. Its IUPAC name is 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-N,N-diethylacetamide.
| Compound Name | 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 115593652 |
| Molecular Formula | C16H21BrN2O2 |
| Molecular Weight | 353.26 g/mol |
| Exact Mass | 352.08 |
| IUPAC Name | 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-N,N-diethylacetamide |
| SMILES | C#CCOc1ccc(Br)cc1CNCC(=O)N(CC)CC |
| InChI | InChI=1S/C16H21BrN2O2/c1-4-9-21-15-8-7-14(17)10-13(15)11-18-12-16(20)19(5-2)6-3/h1,7-8,10,18H,5-6,9,11-12H2,2-3H3 |
| InChIKey | VAXDZAJGBFYPTR-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|