C14H16BrNO3 — CID 60781986
methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]propanoate (PubChem CID 60781986) has the molecular formula C14H16BrNO3 and a molecular weight of 326.19 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]propanoate.
| Compound Name | methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]propanoate |
|---|---|
| PubChem CID | 60781986 |
| Molecular Formula | C14H16BrNO3 |
| Molecular Weight | 326.19 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]propanoate |
| SMILES | C#CCOc1ccc(Br)cc1CNC(C)C(=O)OC |
| InChI | InChI=1S/C14H16BrNO3/c1-4-7-19-13-6-5-12(15)8-11(13)9-16-10(2)14(17)18-3/h1,5-6,8,10,16H,7,9H2,2-3H3 |
| InChIKey | IBPRTKRYBCXTDF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.19 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|