C15H18BrNO3 — CID 60782027
methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-2-methylpropanoate (PubChem CID 60782027) has the molecular formula C15H18BrNO3 and a molecular weight of 340.22 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-2-methylpropanoate.
| Compound Name | methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 60782027 |
| Molecular Formula | C15H18BrNO3 |
| Molecular Weight | 340.22 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | methyl 2-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-2-methylpropanoate |
| SMILES | C#CCOc1ccc(Br)cc1CNC(C)(C)C(=O)OC |
| InChI | InChI=1S/C15H18BrNO3/c1-5-8-20-13-7-6-12(16)9-11(13)10-17-15(2,3)14(18)19-4/h1,6-7,9,17H,8,10H2,2-4H3 |
| InChIKey | VUAPOSITHKDKMJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.22 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|