C15H12BrFN2O — CID 103934218
N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-6-fluoropyridin-3-amine (PubChem CID 103934218) has the molecular formula C15H12BrFN2O and a molecular weight of 335.18 g/mol. Its IUPAC name is N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-6-fluoropyridin-3-amine.
| Compound Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-6-fluoropyridin-3-amine |
|---|---|
| PubChem CID | 103934218 |
| Molecular Formula | C15H12BrFN2O |
| Molecular Weight | 335.18 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-6-fluoropyridin-3-amine |
| SMILES | C#CCOc1ccc(Br)cc1CNc1ccc(F)nc1 |
| InChI | InChI=1S/C15H12BrFN2O/c1-2-7-20-14-5-3-12(16)8-11(14)9-18-13-4-6-15(17)19-10-13/h1,3-6,8,10,18H,7,9H2 |
| InChIKey | OCYKIADMANNILQ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.18 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|