C13H14BrF2NO2 — CID 103731414
3-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-1,1-difluoropropan-2-ol (PubChem CID 103731414) has the molecular formula C13H14BrF2NO2 and a molecular weight of 334.16 g/mol. Its IUPAC name is 3-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-1,1-difluoropropan-2-ol.
| Compound Name | 3-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-1,1-difluoropropan-2-ol |
|---|---|
| PubChem CID | 103731414 |
| Molecular Formula | C13H14BrF2NO2 |
| Molecular Weight | 334.16 g/mol |
| Exact Mass | 333.02 |
| IUPAC Name | 3-[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]-1,1-difluoropropan-2-ol |
| SMILES | C#CCOc1ccc(Br)cc1CNCC(O)C(F)F |
| InChI | InChI=1S/C13H14BrF2NO2/c1-2-5-19-12-4-3-10(14)6-9(12)7-17-8-11(18)13(15)16/h1,3-4,6,11,13,17-18H,5,7-8H2 |
| InChIKey | VYVMBECPVDNGDO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.16 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|