C16H17BrN2OS — CID 104588621
N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-(1,3-thiazol-2-yl)propan-1-amine (PubChem CID 104588621) has the molecular formula C16H17BrN2OS and a molecular weight of 365.30 g/mol. Its IUPAC name is N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-(1,3-thiazol-2-yl)propan-1-amine.
| Compound Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-(1,3-thiazol-2-yl)propan-1-amine |
|---|---|
| PubChem CID | 104588621 |
| Molecular Formula | C16H17BrN2OS |
| Molecular Weight | 365.30 g/mol |
| Exact Mass | 364.02 |
| IUPAC Name | N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-2-(1,3-thiazol-2-yl)propan-1-amine |
| SMILES | C#CCOc1ccc(Br)cc1CNCC(C)c1nccs1 |
| InChI | InChI=1S/C16H17BrN2OS/c1-3-7-20-15-5-4-14(17)9-13(15)11-18-10-12(2)16-19-6-8-21-16/h1,4-6,8-9,12,18H,7,10-11H2,2H3 |
| InChIKey | ROPKSTCUDLPORQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.30 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|