C16H16BrNOS — CID 81398329
(1R)-N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-1-thiophen-2-ylethanamine (PubChem CID 81398329) has the molecular formula C16H16BrNOS and a molecular weight of 350.28 g/mol. Its IUPAC name is (1R)-N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-1-thiophen-2-ylethanamine.
| Compound Name | (1R)-N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 81398329 |
| Molecular Formula | C16H16BrNOS |
| Molecular Weight | 350.28 g/mol |
| Exact Mass | 349.01 |
| IUPAC Name | (1R)-N-[(5-bromo-2-prop-2-ynoxyphenyl)methyl]-1-thiophen-2-ylethanamine |
| SMILES | C#CCOc1ccc(Br)cc1CN[C@H](C)c1cccs1 |
| InChI | InChI=1S/C16H16BrNOS/c1-3-8-19-15-7-6-14(17)10-13(15)11-18-12(2)16-5-4-9-20-16/h1,4-7,9-10,12,18H,8,11H2,2H3/t12-/m1/s1 |
| InChIKey | OPLZHKAOUJHCHZ-GFCCVEGCSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.28 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|