C17H22BrNO2 — CID 64927044
2-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]cyclohexan-1-ol (PubChem CID 64927044) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 2-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]cyclohexan-1-ol.
| Compound Name | 2-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 64927044 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-[[(5-bromo-2-prop-2-ynoxyphenyl)methylamino]methyl]cyclohexan-1-ol |
| SMILES | C#CCOc1ccc(Br)cc1CNCC1CCCCC1O |
| InChI | InChI=1S/C17H22BrNO2/c1-2-9-21-17-8-7-15(18)10-14(17)12-19-11-13-5-3-4-6-16(13)20/h1,7-8,10,13,16,19-20H,3-6,9,11-12H2 |
| InChIKey | SMLABBLNKYDMCF-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|