C10H12N2OS — CID 103605426
N-(1,2-oxazol-5-ylmethyl)-1-thiophen-2-ylethanamine (PubChem CID 103605426) has the molecular formula C10H12N2OS and a molecular weight of 208.29 g/mol. Its IUPAC name is N-(1,2-oxazol-5-ylmethyl)-1-thiophen-2-ylethanamine.
| Compound Name | N-(1,2-oxazol-5-ylmethyl)-1-thiophen-2-ylethanamine |
|---|---|
| PubChem CID | 103605426 |
| Molecular Formula | C10H12N2OS |
| Molecular Weight | 208.29 g/mol |
| Exact Mass | 208.07 |
| IUPAC Name | N-(1,2-oxazol-5-ylmethyl)-1-thiophen-2-ylethanamine |
| SMILES | CC(NCc1ccno1)c1cccs1 |
| InChI | InChI=1S/C10H12N2OS/c1-8(10-3-2-6-14-10)11-7-9-4-5-12-13-9/h2-6,8,11H,7H2,1H3 |
| InChIKey | QKWSDRDSRMSQMQ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |