About 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol
2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol (PubChem CID 106415565) has the molecular formula C12H14N2O3
and a molecular weight of 234.25 g/mol. Its IUPAC name is 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol.
Molecular Properties
| Compound Name | 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol |
| PubChem CID | 106415565 |
| Molecular Formula | C12H14N2O3 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NCc1ccno1)c1c(O)cccc1O |
| InChI | InChI=1S/C12H14N2O3/c1-8(13-7-9-5-6-14-17-9)12-10(15)3-2-4-11(12)16/h2-6,8,13,15-16H,7H2,1H3 |
| InChIKey | CCAJSIJVAKFOPI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol?
The IUPAC name of 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol (CID 106415565) is 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol.
What is the SMILES notation for 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol?
The canonical SMILES for 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol is CC(NCc1ccno1)c1c(O)cccc1O.
What is the InChIKey of 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol?
The InChIKey is CCAJSIJVAKFOPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O3/c1-8(13-7-9-5-6-14-17-9)12-10(15)3-2-4-11(12)16/h2-6,8,13,15-16H,7H2,1H3.
What are the key properties of 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol?
2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol has a molecular weight of 234.25 g/mol, XLogP of 1.94, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(1,2-oxazol-5-ylmethylamino)ethyl]benzene-1,3-diol is sourced from PubChem (CID 106415565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).