C10H13N5O2 — CID 107710894
2-[1-(2H-tetrazol-5-ylmethylamino)ethyl]benzene-1,3-diol (PubChem CID 107710894) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is 2-[1-(2H-tetrazol-5-ylmethylamino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(2H-tetrazol-5-ylmethylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107710894 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 2-[1-(2H-tetrazol-5-ylmethylamino)ethyl]benzene-1,3-diol |
| SMILES | CC(NCc1nn[nH]n1)c1c(O)cccc1O |
| InChI | InChI=1S/C10H13N5O2/c1-6(11-5-9-12-14-15-13-9)10-7(16)3-2-4-8(10)17/h2-4,6,11,16-17H,5H2,1H3,(H,12,13,14,15) |
| InChIKey | GSLHXYUGEWGGSD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 106.95 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|