C12H17NO2 — CID 107711262
2-[1-(but-3-enylamino)ethyl]benzene-1,3-diol (PubChem CID 107711262) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 2-[1-(but-3-enylamino)ethyl]benzene-1,3-diol.
| Compound Name | 2-[1-(but-3-enylamino)ethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 107711262 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 2-[1-(but-3-enylamino)ethyl]benzene-1,3-diol |
| SMILES | C=CCCNC(C)c1c(O)cccc1O |
| InChI | InChI=1S/C12H17NO2/c1-3-4-8-13-9(2)12-10(14)6-5-7-11(12)15/h3,5-7,9,13-15H,1,4,8H2,2H3 |
| InChIKey | NBVILRQGCXPONL-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|