C14H19F2NO — CID 113338705
N-(2-but-3-enoxyethyl)-1-(2,6-difluorophenyl)ethanamine (PubChem CID 113338705) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is N-(2-but-3-enoxyethyl)-1-(2,6-difluorophenyl)ethanamine.
| Compound Name | N-(2-but-3-enoxyethyl)-1-(2,6-difluorophenyl)ethanamine |
|---|---|
| PubChem CID | 113338705 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | N-(2-but-3-enoxyethyl)-1-(2,6-difluorophenyl)ethanamine |
| SMILES | C=CCCOCCNC(C)c1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO/c1-3-4-9-18-10-8-17-11(2)14-12(15)6-5-7-13(14)16/h3,5-7,11,17H,1,4,8-10H2,2H3 |
| InChIKey | VNXCXLLTISBWPZ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|