C14H21NO3 — CID 114183605
2-[1-(2-but-3-enoxyethylamino)ethyl]benzene-1,4-diol (PubChem CID 114183605) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is 2-[1-(2-but-3-enoxyethylamino)ethyl]benzene-1,4-diol.
| Compound Name | 2-[1-(2-but-3-enoxyethylamino)ethyl]benzene-1,4-diol |
|---|---|
| PubChem CID | 114183605 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | 2-[1-(2-but-3-enoxyethylamino)ethyl]benzene-1,4-diol |
| SMILES | C=CCCOCCNC(C)c1cc(O)ccc1O |
| InChI | InChI=1S/C14H21NO3/c1-3-4-8-18-9-7-15-11(2)13-10-12(16)5-6-14(13)17/h3,5-6,10-11,15-17H,1,4,7-9H2,2H3 |
| InChIKey | CBOHIVFXLNNRJA-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|