C16H15N5 — CID 103605630
2-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]benzonitrile (PubChem CID 103605630) has the molecular formula C16H15N5 and a molecular weight of 277.33 g/mol. Its IUPAC name is 2-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]benzonitrile.
| Compound Name | 2-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]benzonitrile |
|---|---|
| PubChem CID | 103605630 |
| Molecular Formula | C16H15N5 |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.13 |
| IUPAC Name | 2-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]benzonitrile |
| SMILES | N#Cc1ccccc1CNCCc1nnc2ccccn12 |
| InChI | InChI=1S/C16H15N5/c17-11-13-5-1-2-6-14(13)12-18-9-8-16-20-19-15-7-3-4-10-21(15)16/h1-7,10,18H,8-9,12H2 |
| InChIKey | SOBIPOJPJQZEIH-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 66.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|