C13H17N7O — CID 66269970
2-[4-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]triazol-1-yl]ethanol (PubChem CID 66269970) has the molecular formula C13H17N7O and a molecular weight of 287.33 g/mol. Its IUPAC name is 2-[4-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]triazol-1-yl]ethanol.
| Compound Name | 2-[4-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]triazol-1-yl]ethanol |
|---|---|
| PubChem CID | 66269970 |
| Molecular Formula | C13H17N7O |
| Molecular Weight | 287.33 g/mol |
| Exact Mass | 287.15 |
| IUPAC Name | 2-[4-[[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethylamino]methyl]triazol-1-yl]ethanol |
| SMILES | OCCn1cc(CNCCc2nnc3ccccn23)nn1 |
| InChI | InChI=1S/C13H17N7O/c21-8-7-19-10-11(15-18-19)9-14-5-4-13-17-16-12-3-1-2-6-20(12)13/h1-3,6,10,14,21H,4-5,7-9H2 |
| InChIKey | NKLLGEZPWUXZTA-UHFFFAOYSA-N |
| XLogP | -0.35 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.33 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|