C8H13N3S2 — CID 103608992
1-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiourea (PubChem CID 103608992) has the molecular formula C8H13N3S2 and a molecular weight of 215.35 g/mol. Its IUPAC name is 1-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiourea.
| Compound Name | 1-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiourea |
|---|---|
| PubChem CID | 103608992 |
| Molecular Formula | C8H13N3S2 |
| Molecular Weight | 215.35 g/mol |
| Exact Mass | 215.06 |
| IUPAC Name | 1-methyl-3-[2-(2-methyl-1,3-thiazol-4-yl)ethyl]thiourea |
| SMILES | CNC(=S)NCCc1csc(C)n1 |
| InChI | InChI=1S/C8H13N3S2/c1-6-11-7(5-13-6)3-4-10-8(12)9-2/h5H,3-4H2,1-2H3,(H2,9,10,12) |
| InChIKey | BWBYNMBSQYGUKU-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.35 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|