C15H8ClF4NO3 — CID 10361242
5-chloro-2-[(2,4-difluorobenzoyl)-(difluoromethyl)amino]benzoic acid (PubChem CID 10361242) has the molecular formula C15H8ClF4NO3 and a molecular weight of 361.68 g/mol. Its IUPAC name is 5-chloro-2-[(2,4-difluorobenzoyl)-(difluoromethyl)amino]benzoic acid.
| Compound Name | 5-chloro-2-[(2,4-difluorobenzoyl)-(difluoromethyl)amino]benzoic acid |
|---|---|
| PubChem CID | 10361242 |
| Molecular Formula | C15H8ClF4NO3 |
| Molecular Weight | 361.68 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | 5-chloro-2-[(2,4-difluorobenzoyl)-(difluoromethyl)amino]benzoic acid |
| SMILES | O=C(O)c1cc(Cl)ccc1N(C(=O)c1ccc(F)cc1F)C(F)F |
| InChI | InChI=1S/C15H8ClF4NO3/c16-7-1-4-12(10(5-7)14(23)24)21(15(19)20)13(22)9-3-2-8(17)6-11(9)18/h1-6,15H,(H,23,24) |
| InChIKey | LPLGRZBBXPWSBT-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|