C18H11Cl3N2O — CID 10362254
(E)-1-(4-chlorophenyl)-3-(3,5-dichlorophenyl)-2-imidazol-1-ylprop-2-en-1-one (PubChem CID 10362254) has the molecular formula C18H11Cl3N2O and a molecular weight of 377.66 g/mol. Its IUPAC name is (E)-1-(4-chlorophenyl)-3-(3,5-dichlorophenyl)-2-imidazol-1-ylprop-2-en-1-one.
| Compound Name | (E)-1-(4-chlorophenyl)-3-(3,5-dichlorophenyl)-2-imidazol-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 10362254 |
| Molecular Formula | C18H11Cl3N2O |
| Molecular Weight | 377.66 g/mol |
| Exact Mass | 375.99 |
| IUPAC Name | (E)-1-(4-chlorophenyl)-3-(3,5-dichlorophenyl)-2-imidazol-1-ylprop-2-en-1-one |
| SMILES | O=C(/C(=C\c1cc(Cl)cc(Cl)c1)n1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H11Cl3N2O/c19-14-3-1-13(2-4-14)18(24)17(23-6-5-22-11-23)9-12-7-15(20)10-16(21)8-12/h1-11H/b17-9+ |
| InChIKey | GTSVVUKPGWYDFJ-RQZCQDPDSA-N |
| XLogP | 5.72 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.66 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|