C20H14BrClN2O — CID 74762691
(2Z,4E)-5-(4-bromophenyl)-1-(4-chlorophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one (PubChem CID 74762691) has the molecular formula C20H14BrClN2O and a molecular weight of 413.70 g/mol. Its IUPAC name is (2Z,4E)-5-(4-bromophenyl)-1-(4-chlorophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-5-(4-bromophenyl)-1-(4-chlorophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 74762691 |
| Molecular Formula | C20H14BrClN2O |
| Molecular Weight | 413.70 g/mol |
| Exact Mass | 412.00 |
| IUPAC Name | (2Z,4E)-5-(4-bromophenyl)-1-(4-chlorophenyl)-2-imidazol-1-ylpenta-2,4-dien-1-one |
| SMILES | O=C(/C(=C/C=C/c1ccc(Br)cc1)n1ccnc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H14BrClN2O/c21-17-8-4-15(5-9-17)2-1-3-19(24-13-12-23-14-24)20(25)16-6-10-18(22)11-7-16/h1-14H/b2-1+,19-3- |
| InChIKey | SBSXIDAVQAFBAH-VHFKVBICSA-N |
| XLogP | 5.74 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.70 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|