C20H13BrCl2N2O — CID 74763762
(2Z,4E)-5-(4-bromophenyl)-2-(4,5-dichloroimidazol-1-yl)-1-phenylpenta-2,4-dien-1-one (PubChem CID 74763762) has the molecular formula C20H13BrCl2N2O and a molecular weight of 448.15 g/mol. Its IUPAC name is (2Z,4E)-5-(4-bromophenyl)-2-(4,5-dichloroimidazol-1-yl)-1-phenylpenta-2,4-dien-1-one.
| Compound Name | (2Z,4E)-5-(4-bromophenyl)-2-(4,5-dichloroimidazol-1-yl)-1-phenylpenta-2,4-dien-1-one |
|---|---|
| PubChem CID | 74763762 |
| Molecular Formula | C20H13BrCl2N2O |
| Molecular Weight | 448.15 g/mol |
| Exact Mass | 445.96 |
| IUPAC Name | (2Z,4E)-5-(4-bromophenyl)-2-(4,5-dichloroimidazol-1-yl)-1-phenylpenta-2,4-dien-1-one |
| SMILES | O=C(/C(=C/C=C/c1ccc(Br)cc1)n1cnc(Cl)c1Cl)c1ccccc1 |
| InChI | InChI=1S/C20H13BrCl2N2O/c21-16-11-9-14(10-12-16)5-4-8-17(25-13-24-19(22)20(25)23)18(26)15-6-2-1-3-7-15/h1-13H/b5-4+,17-8- |
| InChIKey | RHXZQSGZLNSWEW-ZPCHUTRJSA-N |
| XLogP | 6.39 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.15 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|